C11H15IN4 — CID 79785136
1-[(2,5-dimethylpyrazol-3-yl)methyl]-4-iodo-3,5-dimethylpyrazole (PubChem CID 79785136) has the molecular formula C11H15IN4 and a molecular weight of 330.17 g/mol. Its IUPAC name is 1-[(2,5-dimethylpyrazol-3-yl)methyl]-4-iodo-3,5-dimethylpyrazole.
| Compound Name | 1-[(2,5-dimethylpyrazol-3-yl)methyl]-4-iodo-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 79785136 |
| Molecular Formula | C11H15IN4 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 1-[(2,5-dimethylpyrazol-3-yl)methyl]-4-iodo-3,5-dimethylpyrazole |
| SMILES | Cc1cc(Cn2nc(C)c(I)c2C)n(C)n1 |
| InChI | InChI=1S/C11H15IN4/c1-7-5-10(15(4)13-7)6-16-9(3)11(12)8(2)14-16/h5H,6H2,1-4H3 |
| InChIKey | FUSSYGKSLKEHLY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|