C17H22IN3O — CID 24844187
N-(2,6-diethylphenyl)-2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetamide (PubChem CID 24844187) has the molecular formula C17H22IN3O and a molecular weight of 411.29 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 24844187 |
| Molecular Formula | C17H22IN3O |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)Cn1nc(C)c(I)c1C |
| InChI | InChI=1S/C17H22IN3O/c1-5-13-8-7-9-14(6-2)17(13)19-15(22)10-21-12(4)16(18)11(3)20-21/h7-9H,5-6,10H2,1-4H3,(H,19,22) |
| InChIKey | WFCOXLQMZAMOGS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|