C17H19N5O2S — CID 17444231
N-(2,6-diethylphenyl)-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide (PubChem CID 17444231) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 17444231 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)Cn1nnn(-c2cccs2)c1=O |
| InChI | InChI=1S/C17H19N5O2S/c1-3-12-7-5-8-13(4-2)16(12)18-14(23)11-21-17(24)22(20-19-21)15-9-6-10-25-15/h5-10H,3-4,11H2,1-2H3,(H,18,23) |
| InChIKey | SAGBHGBNULHYAK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |