C17H13N5O4S — CID 16580683
N-(4-methyl-2-oxochromen-7-yl)-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide (PubChem CID 16580683) has the molecular formula C17H13N5O4S and a molecular weight of 383.39 g/mol. Its IUPAC name is N-(4-methyl-2-oxochromen-7-yl)-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide.
| Compound Name | N-(4-methyl-2-oxochromen-7-yl)-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 16580683 |
| Molecular Formula | C17H13N5O4S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-(4-methyl-2-oxochromen-7-yl)-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)Cn3nnn(-c4cccs4)c3=O)ccc12 |
| InChI | InChI=1S/C17H13N5O4S/c1-10-7-16(24)26-13-8-11(4-5-12(10)13)18-14(23)9-21-17(25)22(20-19-21)15-3-2-6-27-15/h2-8H,9H2,1H3,(H,18,23) |
| InChIKey | ZGLILJWPRMPALZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|