C20H14N2O5 — CID 19166972
2-(1,3-dioxoisoindol-2-yl)-N-(4-methyl-2-oxochromen-7-yl)acetamide (PubChem CID 19166972) has the molecular formula C20H14N2O5 and a molecular weight of 362.34 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(4-methyl-2-oxochromen-7-yl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-methyl-2-oxochromen-7-yl)acetamide |
|---|---|
| PubChem CID | 19166972 |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-methyl-2-oxochromen-7-yl)acetamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)CN3C(=O)c4ccccc4C3=O)ccc12 |
| InChI | InChI=1S/C20H14N2O5/c1-11-8-18(24)27-16-9-12(6-7-13(11)16)21-17(23)10-22-19(25)14-4-2-3-5-15(14)20(22)26/h2-9H,10H2,1H3,(H,21,23) |
| InChIKey | FZGZXLAZVZUOGL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|