C20H15N3O4 — CID 110427972
2-(1,3-dioxoisoindol-2-yl)-N-(3-methyl-2-oxo-1H-quinolin-7-yl)acetamide (PubChem CID 110427972) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(3-methyl-2-oxo-1H-quinolin-7-yl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(3-methyl-2-oxo-1H-quinolin-7-yl)acetamide |
|---|---|
| PubChem CID | 110427972 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(3-methyl-2-oxo-1H-quinolin-7-yl)acetamide |
| SMILES | Cc1cc2ccc(NC(=O)CN3C(=O)c4ccccc4C3=O)cc2[nH]c1=O |
| InChI | InChI=1S/C20H15N3O4/c1-11-8-12-6-7-13(9-16(12)22-18(11)25)21-17(24)10-23-19(26)14-4-2-3-5-15(14)20(23)27/h2-9H,10H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | XHILAONIWMQCDZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|