C28H24N6O3 — CID 122297706
2-(1,3-dioxoisoindol-2-yl)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 122297706) has the molecular formula C28H24N6O3 and a molecular weight of 492.54 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 122297706 |
| Molecular Formula | C28H24N6O3 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | Cc1ccc(Nc2cc(Nc3ccc(NC(=O)CN4C(=O)c5ccccc5C4=O)cc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C28H24N6O3/c1-17-7-9-19(10-8-17)31-24-15-25(30-18(2)29-24)32-20-11-13-21(14-12-20)33-26(35)16-34-27(36)22-5-3-4-6-23(22)28(34)37/h3-15H,16H2,1-2H3,(H,33,35)(H2,29,30,31,32) |
| InChIKey | RGUAFNKQZPWLAP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|