C20H19NO3S — CID 17488318
N-(4-methyl-2-oxochromen-7-yl)-2-[(3-methylphenyl)methylsulfanyl]acetamide (PubChem CID 17488318) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is N-(4-methyl-2-oxochromen-7-yl)-2-[(3-methylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-(4-methyl-2-oxochromen-7-yl)-2-[(3-methylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 17488318 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-(4-methyl-2-oxochromen-7-yl)-2-[(3-methylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1cccc(CSCC(=O)Nc2ccc3c(C)cc(=O)oc3c2)c1 |
| InChI | InChI=1S/C20H19NO3S/c1-13-4-3-5-15(8-13)11-25-12-19(22)21-16-6-7-17-14(2)9-20(23)24-18(17)10-16/h3-10H,11-12H2,1-2H3,(H,21,22) |
| InChIKey | SAZBDBXMQMVLKC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|