C13H13ClIN3O — CID 5299196
N-(3-chlorophenyl)-2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetamide (PubChem CID 5299196) has the molecular formula C13H13ClIN3O and a molecular weight of 389.62 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 5299196 |
| Molecular Formula | C13H13ClIN3O |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | N-(3-chlorophenyl)-2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2cccc(Cl)c2)c(C)c1I |
| InChI | InChI=1S/C13H13ClIN3O/c1-8-13(15)9(2)18(17-8)7-12(19)16-11-5-3-4-10(14)6-11/h3-6H,7H2,1-2H3,(H,16,19) |
| InChIKey | YDTKGWNYYGMNCO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|