C18H18ClIN6O3 — CID 17083734
3-(3-chlorophenyl)-N-[2-[[2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083734) has the molecular formula C18H18ClIN6O3 and a molecular weight of 528.74 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[2-[[2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(3-chlorophenyl)-N-[2-[[2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083734 |
| Molecular Formula | C18H18ClIN6O3 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[2-[[2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1nn(CC(=O)NCCNC(=O)c2nc(-c3cccc(Cl)c3)no2)c(C)c1I |
| InChI | InChI=1S/C18H18ClIN6O3/c1-10-15(20)11(2)26(24-10)9-14(27)21-6-7-22-17(28)18-23-16(25-29-18)12-4-3-5-13(19)8-12/h3-5,8H,6-7,9H2,1-2H3,(H,21,27)(H,22,28) |
| InChIKey | LUKPJWKGCMGELF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|