C19H20ClN7O6 — CID 17083589
3-(5-chloro-2-methoxyphenyl)-N-[2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083589) has the molecular formula C19H20ClN7O6 and a molecular weight of 477.87 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-N-[2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-N-[2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083589 |
| Molecular Formula | C19H20ClN7O6 |
| Molecular Weight | 477.87 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-N-[2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1-c1noc(C(=O)NCCNC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)n1 |
| InChI | InChI=1S/C19H20ClN7O6/c1-10-16(27(30)31)11(2)26(24-10)9-15(28)21-6-7-22-18(29)19-23-17(25-33-19)13-8-12(20)4-5-14(13)32-3/h4-5,8H,6-7,9H2,1-3H3,(H,21,28)(H,22,29) |
| InChIKey | AGGLPANIWUQKNX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.87 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|