C18H22N10O7 — CID 17085210
N-[2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17085210) has the molecular formula C18H22N10O7 and a molecular weight of 490.44 g/mol. Its IUPAC name is N-[2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17085210 |
| Molecular Formula | C18H22N10O7 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1nn(CC(=O)NCCNC(=O)c2nc(Cn3nc(C)c([N+](=O)[O-])c3C)no2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N10O7/c1-9-15(27(31)32)11(3)25(22-9)7-13-21-18(35-24-13)17(30)20-6-5-19-14(29)8-26-12(4)16(28(33)34)10(2)23-26/h5-8H2,1-4H3,(H,19,29)(H,20,30) |
| InChIKey | GVUBNNWCMDFQCW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 219.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|