C19H20N8O7 — CID 17085187
3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-[(3-methyl-4-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17085187) has the molecular formula C19H20N8O7 and a molecular weight of 472.42 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-[(3-methyl-4-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-[(3-methyl-4-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17085187 |
| Molecular Formula | C19H20N8O7 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-[(3-methyl-4-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)NCCNC(=O)c2nc(Cn3nc(C)c([N+](=O)[O-])c3C)no2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N8O7/c1-10-8-13(4-5-14(10)26(30)31)17(28)20-6-7-21-18(29)19-22-15(24-34-19)9-25-12(3)16(27(32)33)11(2)23-25/h4-5,8H,6-7,9H2,1-3H3,(H,20,28)(H,21,29) |
| InChIKey | OHSYXOKLGPYDOO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 201.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|