C20H23N7O6 — CID 17085191
3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-[[2-(2-methylphenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17085191) has the molecular formula C20H23N7O6 and a molecular weight of 457.45 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-[[2-(2-methylphenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-[[2-(2-methylphenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17085191 |
| Molecular Formula | C20H23N7O6 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-[[2-(2-methylphenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1ccccc1OCC(=O)NCCNC(=O)c1nc(Cn2nc(C)c([N+](=O)[O-])c2C)no1 |
| InChI | InChI=1S/C20H23N7O6/c1-12-6-4-5-7-15(12)32-11-17(28)21-8-9-22-19(29)20-23-16(25-33-20)10-26-14(3)18(27(30)31)13(2)24-26/h4-7H,8-11H2,1-3H3,(H,21,28)(H,22,29) |
| InChIKey | FANWZVCOHBPYSH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|