C9H11N7O4 — CID 17083039
3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carbohydrazide (PubChem CID 17083039) has the molecular formula C9H11N7O4 and a molecular weight of 281.23 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carbohydrazide.
| Compound Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 17083039 |
| Molecular Formula | C9H11N7O4 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carbohydrazide |
| SMILES | Cc1nn(Cc2noc(C(=O)NN)n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N7O4/c1-4-7(16(18)19)5(2)15(13-4)3-6-11-9(20-14-6)8(17)12-10/h3,10H2,1-2H3,(H,12,17) |
| InChIKey | OZEVYLXDIBYOIK-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|