C18H18N6O6 — CID 17083055
methyl 4-[[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carbonyl]amino]methyl]benzoate (PubChem CID 17083055) has the molecular formula C18H18N6O6 and a molecular weight of 414.38 g/mol. Its IUPAC name is methyl 4-[[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carbonyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carbonyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 17083055 |
| Molecular Formula | C18H18N6O6 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | methyl 4-[[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carbonyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)c2nc(Cn3nc(C)c([N+](=O)[O-])c3C)no2)cc1 |
| InChI | InChI=1S/C18H18N6O6/c1-10-15(24(27)28)11(2)23(21-10)9-14-20-17(30-22-14)16(25)19-8-12-4-6-13(7-5-12)18(26)29-3/h4-7H,8-9H2,1-3H3,(H,19,25) |
| InChIKey | GZTKLPQTCYKCOC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 155.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|