C16H17N9O5 — CID 17085171
3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(pyrazine-2-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17085171) has the molecular formula C16H17N9O5 and a molecular weight of 415.37 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(pyrazine-2-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(pyrazine-2-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17085171 |
| Molecular Formula | C16H17N9O5 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(pyrazine-2-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1nn(Cc2noc(C(=O)NCCNC(=O)c3cnccn3)n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N9O5/c1-9-13(25(28)29)10(2)24(22-9)8-12-21-16(30-23-12)15(27)20-6-5-19-14(26)11-7-17-3-4-18-11/h3-4,7H,5-6,8H2,1-2H3,(H,19,26)(H,20,27) |
| InChIKey | BDVTZOWBOLOESO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 183.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|