C20H22ClN7O6 — CID 17085216
N-[2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17085216) has the molecular formula C20H22ClN7O6 and a molecular weight of 491.89 g/mol. Its IUPAC name is N-[2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17085216 |
| Molecular Formula | C20H22ClN7O6 |
| Molecular Weight | 491.89 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-[2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)NCCNC(=O)c1nc(Cn2nc(C)c([N+](=O)[O-])c2C)no1 |
| InChI | InChI=1S/C20H22ClN7O6/c1-11-8-14(21)4-5-15(11)33-10-17(29)22-6-7-23-19(30)20-24-16(26-34-20)9-27-13(3)18(28(31)32)12(2)25-27/h4-5,8H,6-7,9-10H2,1-3H3,(H,22,29)(H,23,30) |
| InChIKey | FZWSNLCVYFONKN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.89 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|