C18H18ClN7O6 — CID 17084652
N-[2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084652) has the molecular formula C18H18ClN7O6 and a molecular weight of 463.84 g/mol. Its IUPAC name is N-[2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084652 |
| Molecular Formula | C18H18ClN7O6 |
| Molecular Weight | 463.84 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | N-[2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)NCCNC(=O)c1nc(Cn2cc([N+](=O)[O-])cn2)no1 |
| InChI | InChI=1S/C18H18ClN7O6/c1-11-6-12(19)2-3-14(11)31-10-16(27)20-4-5-21-17(28)18-23-15(24-32-18)9-25-8-13(7-22-25)26(29)30/h2-3,6-8H,4-5,9-10H2,1H3,(H,20,27)(H,21,28) |
| InChIKey | UGBJXGCAPZGPEW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.84 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|