C14H13N7O6 — CID 17084615
N-[2-(furan-2-carbonylamino)ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084615) has the molecular formula C14H13N7O6 and a molecular weight of 375.30 g/mol. Its IUPAC name is N-[2-(furan-2-carbonylamino)ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-(furan-2-carbonylamino)ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084615 |
| Molecular Formula | C14H13N7O6 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[2-(furan-2-carbonylamino)ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1nc(Cn2cc([N+](=O)[O-])cn2)no1)c1ccco1 |
| InChI | InChI=1S/C14H13N7O6/c22-12(10-2-1-5-26-10)15-3-4-16-13(23)14-18-11(19-27-14)8-20-7-9(6-17-20)21(24)25/h1-2,5-7H,3-4,8H2,(H,15,22)(H,16,23) |
| InChIKey | YCVQSGILADWQMH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|