C12H10N6O5 — CID 5298140
N-(furan-2-ylmethyl)-3-[(3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 5298140) has the molecular formula C12H10N6O5 and a molecular weight of 318.25 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[(3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[(3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 5298140 |
| Molecular Formula | C12H10N6O5 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[(3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCc1ccco1)c1nc(Cn2ccc([N+](=O)[O-])n2)no1 |
| InChI | InChI=1S/C12H10N6O5/c19-11(13-6-8-2-1-5-22-8)12-14-9(16-23-12)7-17-4-3-10(15-17)18(20)21/h1-5H,6-7H2,(H,13,19) |
| InChIKey | NQGNFWKLNJFPSH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 142.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|