C19H22N6O6 — CID 17083016
N-[2-(3,4-diethoxyphenyl)ethyl]-3-[(3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083016) has the molecular formula C19H22N6O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-3-[(3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-[(3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083016 |
| Molecular Formula | C19H22N6O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-[(3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)c2nc(Cn3ccc([N+](=O)[O-])n3)no2)cc1OCC |
| InChI | InChI=1S/C19H22N6O6/c1-3-29-14-6-5-13(11-15(14)30-4-2)7-9-20-18(26)19-21-16(23-31-19)12-24-10-8-17(22-24)25(27)28/h5-6,8,10-11H,3-4,7,9,12H2,1-2H3,(H,20,26) |
| InChIKey | GBVBISRKKDRFCI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|