C19H22N2O5 — CID 8781305
N-[2-(3,4-diethoxyphenyl)ethyl]-3-nitrobenzamide (PubChem CID 8781305) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-3-nitrobenzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 8781305 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-nitrobenzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2cccc([N+](=O)[O-])c2)cc1OCC |
| InChI | InChI=1S/C19H22N2O5/c1-3-25-17-9-8-14(12-18(17)26-4-2)10-11-20-19(22)15-6-5-7-16(13-15)21(23)24/h5-9,12-13H,3-4,10-11H2,1-2H3,(H,20,22) |
| InChIKey | VXJPPYDWVRYETK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|