C24H32N4O5 — CID 110839566
N-[2-(3,4-diethoxyphenyl)ethyl]-4-(4-methylpiperazin-1-yl)-3-nitrobenzamide (PubChem CID 110839566) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-4-(4-methylpiperazin-1-yl)-3-nitrobenzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(4-methylpiperazin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 110839566 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(4-methylpiperazin-1-yl)-3-nitrobenzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(N3CCN(C)CC3)c([N+](=O)[O-])c2)cc1OCC |
| InChI | InChI=1S/C24H32N4O5/c1-4-32-22-9-6-18(16-23(22)33-5-2)10-11-25-24(29)19-7-8-20(21(17-19)28(30)31)27-14-12-26(3)13-15-27/h6-9,16-17H,4-5,10-15H2,1-3H3,(H,25,29) |
| InChIKey | SAGCOHHSLSMASX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|