C20H23ClN6O6 — CID 17083109
3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083109) has the molecular formula C20H23ClN6O6 and a molecular weight of 478.89 g/mol. Its IUPAC name is 3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083109 |
| Molecular Formula | C20H23ClN6O6 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)c2nc(Cn3nc([N+](=O)[O-])c(Cl)c3C)no2)cc1OCC |
| InChI | InChI=1S/C20H23ClN6O6/c1-4-31-14-7-6-13(10-15(14)32-5-2)8-9-22-19(28)20-23-16(25-33-20)11-26-12(3)17(21)18(24-26)27(29)30/h6-7,10H,4-5,8-9,11H2,1-3H3,(H,22,28) |
| InChIKey | VSJWZYPPCPBIAQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|