C20H22BrN7O8 — CID 17085236
3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17085236) has the molecular formula C20H22BrN7O8 and a molecular weight of 568.34 g/mol. Its IUPAC name is 3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17085236 |
| Molecular Formula | C20H22BrN7O8 |
| Molecular Weight | 568.34 g/mol |
| Exact Mass | 567.07 |
| IUPAC Name | 3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1cc(C(=O)NCCNC(=O)c2nc(Cn3nc([N+](=O)[O-])c(Br)c3C)no2)cc(OC)c1OC |
| InChI | InChI=1S/C20H22BrN7O8/c1-10-15(21)17(28(31)32)25-27(10)9-14-24-20(36-26-14)19(30)23-6-5-22-18(29)11-7-12(33-2)16(35-4)13(8-11)34-3/h7-8H,5-6,9H2,1-4H3,(H,22,29)(H,23,30) |
| InChIKey | SWZRFQIQDDCKIN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 185.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|