C18H18BrN7O5 — CID 17085127
3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17085127) has the molecular formula C18H18BrN7O5 and a molecular weight of 492.29 g/mol. Its IUPAC name is 3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17085127 |
| Molecular Formula | C18H18BrN7O5 |
| Molecular Weight | 492.29 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1nn(Cc2noc(C(=O)NCCNC(=O)c3cccc([N+](=O)[O-])c3)n2)c(C)c1Br |
| InChI | InChI=1S/C18H18BrN7O5/c1-10-15(19)11(2)25(23-10)9-14-22-18(31-24-14)17(28)21-7-6-20-16(27)12-4-3-5-13(8-12)26(29)30/h3-5,8H,6-7,9H2,1-2H3,(H,20,27)(H,21,28) |
| InChIKey | ARRCUIXNHREAAD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|