C19H20IN7O5 — CID 17084762
3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3-methyl-4-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084762) has the molecular formula C19H20IN7O5 and a molecular weight of 553.32 g/mol. Its IUPAC name is 3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3-methyl-4-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3-methyl-4-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084762 |
| Molecular Formula | C19H20IN7O5 |
| Molecular Weight | 553.32 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | 3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3-methyl-4-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)NCCNC(=O)c2nc(Cn3nc(C)c(I)c3C)no2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20IN7O5/c1-10-8-13(4-5-14(10)27(30)31)17(28)21-6-7-22-18(29)19-23-15(25-32-19)9-26-12(3)16(20)11(2)24-26/h4-5,8H,6-7,9H2,1-3H3,(H,21,28)(H,22,29) |
| InChIKey | VKZYVFXHQYYJID-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|