C17H19ClIN9O5 — CID 17084857
3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[[2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084857) has the molecular formula C17H19ClIN9O5 and a molecular weight of 591.75 g/mol. Its IUPAC name is 3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[[2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[[2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084857 |
| Molecular Formula | C17H19ClIN9O5 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.02 |
| IUPAC Name | 3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[[2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1nn(CC(=O)NCCNC(=O)c2nc(Cn3nc([N+](=O)[O-])c(Cl)c3C)no2)c(C)c1I |
| InChI | InChI=1S/C17H19ClIN9O5/c1-8-14(19)10(3)27(23-8)7-12(29)20-4-5-21-16(30)17-22-11(25-33-17)6-26-9(2)13(18)15(24-26)28(31)32/h4-7H2,1-3H3,(H,20,29)(H,21,30) |
| InChIKey | ZAHBDESMMXMLMC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 175.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|