C14H12ClN7O4 — CID 17083090
3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-(pyridin-3-ylmethyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083090) has the molecular formula C14H12ClN7O4 and a molecular weight of 377.75 g/mol. Its IUPAC name is 3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-(pyridin-3-ylmethyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-(pyridin-3-ylmethyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083090 |
| Molecular Formula | C14H12ClN7O4 |
| Molecular Weight | 377.75 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-N-(pyridin-3-ylmethyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1c(Cl)c([N+](=O)[O-])nn1Cc1noc(C(=O)NCc2cccnc2)n1 |
| InChI | InChI=1S/C14H12ClN7O4/c1-8-11(15)12(22(24)25)19-21(8)7-10-18-14(26-20-10)13(23)17-6-9-3-2-4-16-5-9/h2-5H,6-7H2,1H3,(H,17,23) |
| InChIKey | AGYWDZSEFWDLQH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 141.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.75 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|