C18H18BrN7O6 — CID 17085234
3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(2-methoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17085234) has the molecular formula C18H18BrN7O6 and a molecular weight of 508.29 g/mol. Its IUPAC name is 3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(2-methoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(2-methoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17085234 |
| Molecular Formula | C18H18BrN7O6 |
| Molecular Weight | 508.29 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | 3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(2-methoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccccc1C(=O)NCCNC(=O)c1nc(Cn2nc([N+](=O)[O-])c(Br)c2C)no1 |
| InChI | InChI=1S/C18H18BrN7O6/c1-10-14(19)15(26(29)30)23-25(10)9-13-22-18(32-24-13)17(28)21-8-7-20-16(27)11-5-3-4-6-12(11)31-2/h3-6H,7-9H2,1-2H3,(H,20,27)(H,21,28) |
| InChIKey | LVGNWGLNZNGSFI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|