C19H19BrClN7O6 — CID 17084863
N-[2-[2-(3-bromophenoxy)propanoylamino]ethyl]-3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084863) has the molecular formula C19H19BrClN7O6 and a molecular weight of 556.76 g/mol. Its IUPAC name is N-[2-[2-(3-bromophenoxy)propanoylamino]ethyl]-3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[2-(3-bromophenoxy)propanoylamino]ethyl]-3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084863 |
| Molecular Formula | C19H19BrClN7O6 |
| Molecular Weight | 556.76 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | N-[2-[2-(3-bromophenoxy)propanoylamino]ethyl]-3-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1c(Cl)c([N+](=O)[O-])nn1Cc1noc(C(=O)NCCNC(=O)C(C)Oc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C19H19BrClN7O6/c1-10-15(21)16(28(31)32)25-27(10)9-14-24-19(34-26-14)18(30)23-7-6-22-17(29)11(2)33-13-5-3-4-12(20)8-13/h3-5,8,11H,6-7,9H2,1-2H3,(H,22,29)(H,23,30) |
| InChIKey | JSPOZHBXNGVJFQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.76 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|