C18H17Cl2N7O5 — CID 17084907
3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(4-chloro-3-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084907) has the molecular formula C18H17Cl2N7O5 and a molecular weight of 482.28 g/mol. Its IUPAC name is 3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(4-chloro-3-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(4-chloro-3-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084907 |
| Molecular Formula | C18H17Cl2N7O5 |
| Molecular Weight | 482.28 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(4-chloro-3-nitrobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1nn(Cc2noc(C(=O)NCCNC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)n2)c(C)c1Cl |
| InChI | InChI=1S/C18H17Cl2N7O5/c1-9-15(20)10(2)26(24-9)8-14-23-18(32-25-14)17(29)22-6-5-21-16(28)11-3-4-12(19)13(7-11)27(30)31/h3-4,7H,5-6,8H2,1-2H3,(H,21,28)(H,22,29) |
| InChIKey | NSIPCZBNUWPNPG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|