C17H18N8O5 — CID 17085205
3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17085205) has the molecular formula C17H18N8O5 and a molecular weight of 414.38 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17085205 |
| Molecular Formula | C17H18N8O5 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1nn(Cc2noc(C(=O)NCCNC(=O)c3cccnc3)n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N8O5/c1-10-14(25(28)29)11(2)24(22-10)9-13-21-17(30-23-13)16(27)20-7-6-19-15(26)12-4-3-5-18-8-12/h3-5,8H,6-7,9H2,1-2H3,(H,19,26)(H,20,27) |
| InChIKey | WXZJOQQOYSUXDW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 170.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|