C19H19Cl2IN6O4 — CID 17084757
N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]-3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084757) has the molecular formula C19H19Cl2IN6O4 and a molecular weight of 593.21 g/mol. Its IUPAC name is N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]-3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]-3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084757 |
| Molecular Formula | C19H19Cl2IN6O4 |
| Molecular Weight | 593.21 g/mol |
| Exact Mass | 591.99 |
| IUPAC Name | N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]ethyl]-3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1nn(Cc2noc(C(=O)NCCNC(=O)COc3ccc(Cl)cc3Cl)n2)c(C)c1I |
| InChI | InChI=1S/C19H19Cl2IN6O4/c1-10-17(22)11(2)28(26-10)8-15-25-19(32-27-15)18(30)24-6-5-23-16(29)9-31-14-4-3-12(20)7-13(14)21/h3-4,7H,5-6,8-9H2,1-2H3,(H,23,29)(H,24,30) |
| InChIKey | JETRRVYWOTXBES-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|