C20H20F3IN6O4 — CID 17084755
3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084755) has the molecular formula C20H20F3IN6O4 and a molecular weight of 592.32 g/mol. Its IUPAC name is 3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084755 |
| Molecular Formula | C20H20F3IN6O4 |
| Molecular Weight | 592.32 g/mol |
| Exact Mass | 592.05 |
| IUPAC Name | 3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1nn(Cc2noc(C(=O)NCCNC(=O)COc3cccc(C(F)(F)F)c3)n2)c(C)c1I |
| InChI | InChI=1S/C20H20F3IN6O4/c1-11-17(24)12(2)30(28-11)9-15-27-19(34-29-15)18(32)26-7-6-25-16(31)10-33-14-5-3-4-13(8-14)20(21,22)23/h3-5,8H,6-7,9-10H2,1-2H3,(H,25,31)(H,26,32) |
| InChIKey | COUKQOMXJSKMLK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|