C20H16ClF3N4O4 — CID 17083705
3-(3-chlorophenyl)-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083705) has the molecular formula C20H16ClF3N4O4 and a molecular weight of 468.82 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(3-chlorophenyl)-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083705 |
| Molecular Formula | C20H16ClF3N4O4 |
| Molecular Weight | 468.82 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)NCCNC(=O)c1nc(-c2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C20H16ClF3N4O4/c21-14-5-1-3-12(9-14)17-27-19(32-28-17)18(30)26-8-7-25-16(29)11-31-15-6-2-4-13(10-15)20(22,23)24/h1-6,9-10H,7-8,11H2,(H,25,29)(H,26,30) |
| InChIKey | FDJKWPBHXJBQFS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|