C21H25IN6O6 — CID 17084738
3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084738) has the molecular formula C21H25IN6O6 and a molecular weight of 584.37 g/mol. Its IUPAC name is 3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084738 |
| Molecular Formula | C21H25IN6O6 |
| Molecular Weight | 584.37 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | 3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1cc(C(=O)NCCNC(=O)c2nc(Cn3nc(C)c(I)c3C)no2)cc(OC)c1OC |
| InChI | InChI=1S/C21H25IN6O6/c1-11-17(22)12(2)28(26-11)10-16-25-21(34-27-16)20(30)24-7-6-23-19(29)13-8-14(31-3)18(33-5)15(9-13)32-4/h8-9H,6-7,10H2,1-5H3,(H,23,29)(H,24,30) |
| InChIKey | VTIGYSPEWWKUFU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|