C19H21N7O8 — CID 5311700
3-[(4-nitropyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 5311700) has the molecular formula C19H21N7O8 and a molecular weight of 475.42 g/mol. Its IUPAC name is 3-[(4-nitropyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-nitropyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 5311700 |
| Molecular Formula | C19H21N7O8 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 3-[(4-nitropyrazol-1-yl)methyl]-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1cc(C(=O)NCCNC(=O)c2nc(Cn3cc([N+](=O)[O-])cn3)no2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N7O8/c1-31-13-6-11(7-14(32-2)16(13)33-3)17(27)20-4-5-21-18(28)19-23-15(24-34-19)10-25-9-12(8-22-25)26(29)30/h6-9H,4-5,10H2,1-3H3,(H,20,27)(H,21,28) |
| InChIKey | CDIIZLAHOUFFOB-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 185.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|