C17H15N7O7 — CID 5306458
N-[2-(1,3-benzodioxole-5-carbonylamino)ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 5306458) has the molecular formula C17H15N7O7 and a molecular weight of 429.35 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxole-5-carbonylamino)ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-(1,3-benzodioxole-5-carbonylamino)ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 5306458 |
| Molecular Formula | C17H15N7O7 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | N-[2-(1,3-benzodioxole-5-carbonylamino)ethyl]-3-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1nc(Cn2cc([N+](=O)[O-])cn2)no1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15N7O7/c25-15(10-1-2-12-13(5-10)30-9-29-12)18-3-4-19-16(26)17-21-14(22-31-17)8-23-7-11(6-20-23)24(27)28/h1-2,5-7H,3-4,8-9H2,(H,18,25)(H,19,26) |
| InChIKey | VAJCYNCZQLMSMO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 176.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|