C15H14IN7O3 — CID 17084996
3-[(4-iodopyrazol-1-yl)methyl]-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084996) has the molecular formula C15H14IN7O3 and a molecular weight of 467.23 g/mol. Its IUPAC name is 3-[(4-iodopyrazol-1-yl)methyl]-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-iodopyrazol-1-yl)methyl]-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084996 |
| Molecular Formula | C15H14IN7O3 |
| Molecular Weight | 467.23 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | 3-[(4-iodopyrazol-1-yl)methyl]-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1nc(Cn2cc(I)cn2)no1)c1cccnc1 |
| InChI | InChI=1S/C15H14IN7O3/c16-11-7-20-23(8-11)9-12-21-15(26-22-12)14(25)19-5-4-18-13(24)10-2-1-3-17-6-10/h1-3,6-8H,4-5,9H2,(H,18,24)(H,19,25) |
| InChIKey | CPAOJDRMLTXONK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|