C16H16IN5O3 — CID 17082998
3-[(4-iodopyrazol-1-yl)methyl]-N-[2-(2-methoxyphenyl)ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17082998) has the molecular formula C16H16IN5O3 and a molecular weight of 453.24 g/mol. Its IUPAC name is 3-[(4-iodopyrazol-1-yl)methyl]-N-[2-(2-methoxyphenyl)ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-iodopyrazol-1-yl)methyl]-N-[2-(2-methoxyphenyl)ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17082998 |
| Molecular Formula | C16H16IN5O3 |
| Molecular Weight | 453.24 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 3-[(4-iodopyrazol-1-yl)methyl]-N-[2-(2-methoxyphenyl)ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)c1nc(Cn2cc(I)cn2)no1 |
| InChI | InChI=1S/C16H16IN5O3/c1-24-13-5-3-2-4-11(13)6-7-18-15(23)16-20-14(21-25-16)10-22-9-12(17)8-19-22/h2-5,8-9H,6-7,10H2,1H3,(H,18,23) |
| InChIKey | ZFSOJKMPHGYEDT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|