C18H19IN6O4 — CID 17084960
N-[2-[(4-ethoxybenzoyl)amino]ethyl]-3-[(4-iodopyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084960) has the molecular formula C18H19IN6O4 and a molecular weight of 510.29 g/mol. Its IUPAC name is N-[2-[(4-ethoxybenzoyl)amino]ethyl]-3-[(4-iodopyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(4-ethoxybenzoyl)amino]ethyl]-3-[(4-iodopyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084960 |
| Molecular Formula | C18H19IN6O4 |
| Molecular Weight | 510.29 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | N-[2-[(4-ethoxybenzoyl)amino]ethyl]-3-[(4-iodopyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCOc1ccc(C(=O)NCCNC(=O)c2nc(Cn3cc(I)cn3)no2)cc1 |
| InChI | InChI=1S/C18H19IN6O4/c1-2-28-14-5-3-12(4-6-14)16(26)20-7-8-21-17(27)18-23-15(24-29-18)11-25-10-13(19)9-22-25/h3-6,9-10H,2,7-8,11H2,1H3,(H,20,26)(H,21,27) |
| InChIKey | DWJGQCNZCKAGMN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|