C18H19IN6O5 — CID 17085004
3-[(4-iodopyrazol-1-yl)methyl]-N-[2-[[2-(4-methoxyphenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17085004) has the molecular formula C18H19IN6O5 and a molecular weight of 526.29 g/mol. Its IUPAC name is 3-[(4-iodopyrazol-1-yl)methyl]-N-[2-[[2-(4-methoxyphenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-iodopyrazol-1-yl)methyl]-N-[2-[[2-(4-methoxyphenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17085004 |
| Molecular Formula | C18H19IN6O5 |
| Molecular Weight | 526.29 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | 3-[(4-iodopyrazol-1-yl)methyl]-N-[2-[[2-(4-methoxyphenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccc(OCC(=O)NCCNC(=O)c2nc(Cn3cc(I)cn3)no2)cc1 |
| InChI | InChI=1S/C18H19IN6O5/c1-28-13-2-4-14(5-3-13)29-11-16(26)20-6-7-21-17(27)18-23-15(24-30-18)10-25-9-12(19)8-22-25/h2-5,8-9H,6-7,10-11H2,1H3,(H,20,26)(H,21,27) |
| InChIKey | KZDXBIVTRNOREM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|