C21H25IN6O4 — CID 17084767
N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084767) has the molecular formula C21H25IN6O4 and a molecular weight of 552.37 g/mol. Its IUPAC name is N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084767 |
| Molecular Formula | C21H25IN6O4 |
| Molecular Weight | 552.37 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-3-[(4-iodo-3,5-dimethylpyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cccc(OCC(=O)NCCNC(=O)c2nc(Cn3nc(C)c(I)c3C)no2)c1C |
| InChI | InChI=1S/C21H25IN6O4/c1-12-6-5-7-16(13(12)2)31-11-18(29)23-8-9-24-20(30)21-25-17(27-32-21)10-28-15(4)19(22)14(3)26-28/h5-7H,8-11H2,1-4H3,(H,23,29)(H,24,30) |
| InChIKey | CHSPPBRDPBHUKH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|