C18H17Br2N7O6 — CID 17084685
N-[2-[[2-(2,4-dibromophenoxy)acetyl]amino]ethyl]-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084685) has the molecular formula C18H17Br2N7O6 and a molecular weight of 587.19 g/mol. Its IUPAC name is N-[2-[[2-(2,4-dibromophenoxy)acetyl]amino]ethyl]-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[[2-(2,4-dibromophenoxy)acetyl]amino]ethyl]-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084685 |
| Molecular Formula | C18H17Br2N7O6 |
| Molecular Weight | 587.19 g/mol |
| Exact Mass | 584.96 |
| IUPAC Name | N-[2-[[2-(2,4-dibromophenoxy)acetyl]amino]ethyl]-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1Cc1noc(C(=O)NCCNC(=O)COc2ccc(Br)cc2Br)n1 |
| InChI | InChI=1S/C18H17Br2N7O6/c1-10-6-15(27(30)31)24-26(10)8-14-23-18(33-25-14)17(29)22-5-4-21-16(28)9-32-13-3-2-11(19)7-12(13)20/h2-3,6-7H,4-5,8-9H2,1H3,(H,21,28)(H,22,29) |
| InChIKey | LMCOJSXCOSOHGX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|