C17H15Cl2N7O5 — CID 17084664
N-[2-[(2,4-dichlorobenzoyl)amino]ethyl]-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084664) has the molecular formula C17H15Cl2N7O5 and a molecular weight of 468.26 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorobenzoyl)amino]ethyl]-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(2,4-dichlorobenzoyl)amino]ethyl]-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084664 |
| Molecular Formula | C17H15Cl2N7O5 |
| Molecular Weight | 468.26 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | N-[2-[(2,4-dichlorobenzoyl)amino]ethyl]-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1Cc1noc(C(=O)NCCNC(=O)c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C17H15Cl2N7O5/c1-9-6-14(26(29)30)23-25(9)8-13-22-17(31-24-13)16(28)21-5-4-20-15(27)11-3-2-10(18)7-12(11)19/h2-3,6-7H,4-5,8H2,1H3,(H,20,27)(H,21,28) |
| InChIKey | AGAIYNVPQLMRAY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|