C16H16N6O4 — CID 17082886
3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-(1-phenylethyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17082886) has the molecular formula C16H16N6O4 and a molecular weight of 356.34 g/mol. Its IUPAC name is 3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-(1-phenylethyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-(1-phenylethyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17082886 |
| Molecular Formula | C16H16N6O4 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-(1-phenylethyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1Cc1noc(C(=O)NC(C)c2ccccc2)n1 |
| InChI | InChI=1S/C16H16N6O4/c1-10-8-14(22(24)25)19-21(10)9-13-18-16(26-20-13)15(23)17-11(2)12-6-4-3-5-7-12/h3-8,11H,9H2,1-2H3,(H,17,23) |
| InChIKey | CQJGYIAXOCMXDQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|