C22H22N6O4 — CID 19442599
5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-[1-(3-pyrrol-1-ylphenyl)ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 19442599) has the molecular formula C22H22N6O4 and a molecular weight of 434.46 g/mol. Its IUPAC name is 5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-[1-(3-pyrrol-1-ylphenyl)ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-[1-(3-pyrrol-1-ylphenyl)ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442599 |
| Molecular Formula | C22H22N6O4 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-[1-(3-pyrrol-1-ylphenyl)ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(=O)NC(C)c2cccc(-n3cccc3)c2)c1Cn1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C22H22N6O4/c1-14-11-20(28(30)31)24-27(14)13-19-16(3)32-25-21(19)22(29)23-15(2)17-7-6-8-18(12-17)26-9-4-5-10-26/h4-12,15H,13H2,1-3H3,(H,23,29) |
| InChIKey | DRCLSWWLHCUBIB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|