C17H16ClN5O4 — CID 19442527
N-[(2-chlorophenyl)methyl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 19442527) has the molecular formula C17H16ClN5O4 and a molecular weight of 389.80 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442527 |
| Molecular Formula | C17H16ClN5O4 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(=O)NCc2ccccc2Cl)c1Cn1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C17H16ClN5O4/c1-10-7-15(23(25)26)20-22(10)9-13-11(2)27-21-16(13)17(24)19-8-12-5-3-4-6-14(12)18/h3-7H,8-9H2,1-2H3,(H,19,24) |
| InChIKey | KSWUKKUQCMAHAY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|